C19H30N4O6 — CID 142034450
tert-butyl N-butoxycarbonyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate (PubChem CID 142034450) has the molecular formula C19H30N4O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is tert-butyl N-butoxycarbonyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate.
| Compound Name | tert-butyl N-butoxycarbonyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 142034450 |
| Molecular Formula | C19H30N4O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl N-butoxycarbonyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate |
| SMILES | CCCCOC(=O)N(C(=O)OC(C)(C)C)C(=NC(=O)OC(C)(C)C)n1cccn1 |
| InChI | InChI=1S/C19H30N4O6/c1-8-9-13-27-16(25)23(17(26)29-19(5,6)7)14(22-12-10-11-20-22)21-15(24)28-18(2,3)4/h10-12H,8-9,13H2,1-7H3 |
| InChIKey | DWFSKAQWOCTAPK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 112.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|