C8H11N3O — CID 54498437
4-methyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one (PubChem CID 54498437) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-methyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one.
| Compound Name | 4-methyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 54498437 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-methyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| SMILES | C=C(C(=O)C(C)C)n1cncn1 |
| InChI | InChI=1S/C8H11N3O/c1-6(2)8(12)7(3)11-5-9-4-10-11/h4-6H,3H2,1-2H3 |
| InChIKey | YATIEZDLGNBVEL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|