C9H9Cl2N3O2 — CID 13292243
3-[2,2-dichloro-1-(1,2,4-triazol-1-yl)ethenyl]pentane-2,4-dione (PubChem CID 13292243) has the molecular formula C9H9Cl2N3O2 and a molecular weight of 262.10 g/mol. Its IUPAC name is 3-[2,2-dichloro-1-(1,2,4-triazol-1-yl)ethenyl]pentane-2,4-dione.
| Compound Name | 3-[2,2-dichloro-1-(1,2,4-triazol-1-yl)ethenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 13292243 |
| Molecular Formula | C9H9Cl2N3O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 3-[2,2-dichloro-1-(1,2,4-triazol-1-yl)ethenyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(=C(Cl)Cl)n1cncn1 |
| InChI | InChI=1S/C9H9Cl2N3O2/c1-5(15)7(6(2)16)8(9(10)11)14-4-12-3-13-14/h3-4,7H,1-2H3 |
| InChIKey | CLDMDRWUZYYUSV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|