C8H12N4 — CID 68830180
(1S,4R)-4-(1,2,4-triazol-1-ylmethyl)cyclopent-2-en-1-amine (PubChem CID 68830180) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is (1S,4R)-4-(1,2,4-triazol-1-ylmethyl)cyclopent-2-en-1-amine.
| Compound Name | (1S,4R)-4-(1,2,4-triazol-1-ylmethyl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 68830180 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | (1S,4R)-4-(1,2,4-triazol-1-ylmethyl)cyclopent-2-en-1-amine |
| SMILES | N[C@@H]1C=C[C@H](Cn2cncn2)C1 |
| InChI | InChI=1S/C8H12N4/c9-8-2-1-7(3-8)4-12-6-10-5-11-12/h1-2,5-8H,3-4,9H2/t7-,8+/m0/s1 |
| InChIKey | CTEYSIPRPAKXNG-JGVFFNPUSA-N |
| XLogP | 0.18 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|