C8H11N3 — CID 13491239
1-cyclohex-2-en-1-yl-1,2,4-triazole (PubChem CID 13491239) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-1,2,4-triazole.
| Compound Name | 1-cyclohex-2-en-1-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 13491239 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-1,2,4-triazole |
| SMILES | C1=CC(n2cncn2)CCC1 |
| InChI | InChI=1S/C8H11N3/c1-2-4-8(5-3-1)11-7-9-6-10-11/h2,4,6-8H,1,3,5H2 |
| InChIKey | MIMVFXNPENPKIG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|