C14H21N5 — CID 143020150
(Z)-N-(5-ethenyl-1,2-dihydropyridin-6-yl)butan-1-imine;1-methyl-1,2,4-triazole (PubChem CID 143020150) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is (Z)-N-(5-ethenyl-1,2-dihydropyridin-6-yl)butan-1-imine;1-methyl-1,2,4-triazole.
| Compound Name | (Z)-N-(5-ethenyl-1,2-dihydropyridin-6-yl)butan-1-imine;1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 143020150 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | (Z)-N-(5-ethenyl-1,2-dihydropyridin-6-yl)butan-1-imine;1-methyl-1,2,4-triazole |
| SMILES | C=CC1=C(/N=C\CCC)NCC=C1.Cn1cncn1 |
| InChI | InChI=1S/C11H16N2.C3H5N3/c1-3-5-8-12-11-10(4-2)7-6-9-13-11;1-6-3-4-2-5-6/h4,6-8,13H,2-3,5,9H2,1H3;2-3H,1H3/b12-8-; |
| InChIKey | QSKHQPNJJVXPFM-JCTPKUEWSA-N |
| XLogP | 2.23 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|