C18H27N5 — CID 143915077
(2E,4Z,7Z)-N-[(E)-but-1-enyl]-9-imino-6-methylidene-9-(1,2,4-triazol-1-yl)nona-2,4,7-trien-5-amine;ethane (PubChem CID 143915077) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is (2E,4Z,7Z)-N-[(E)-but-1-enyl]-9-imino-6-methylidene-9-(1,2,4-triazol-1-yl)nona-2,4,7-trien-5-amine;ethane.
| Compound Name | (2E,4Z,7Z)-N-[(E)-but-1-enyl]-9-imino-6-methylidene-9-(1,2,4-triazol-1-yl)nona-2,4,7-trien-5-amine;ethane |
|---|---|
| PubChem CID | 143915077 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (2E,4Z,7Z)-N-[(E)-but-1-enyl]-9-imino-6-methylidene-9-(1,2,4-triazol-1-yl)nona-2,4,7-trien-5-amine;ethane |
| SMILES | CC.[H]/N=C(/C=C\C(=C)/C(=C/C=C/C)N/C=C/CC)n1cncn1 |
| InChI | InChI=1S/C16H21N5.C2H6/c1-4-6-8-15(19-11-7-5-2)14(3)9-10-16(17)21-13-18-12-20-21;1-2/h4,6-13,17,19H,3,5H2,1-2H3;1-2H3/b6-4+,10-9-,11-7+,15-8-,17-16-; |
| InChIKey | LZRRDUHVSFTNQL-OTJLOPKZSA-N |
| XLogP | 4.22 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|