C31H33N3O4 — CID 142899776
ethane;N-(1-hydroxycyclopropyl)-1-[3-[4-(3-hydroxy-2-methylbut-3-enyl)phenyl]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 142899776) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is ethane;N-(1-hydroxycyclopropyl)-1-[3-[4-(3-hydroxy-2-methylbut-3-enyl)phenyl]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | ethane;N-(1-hydroxycyclopropyl)-1-[3-[4-(3-hydroxy-2-methylbut-3-enyl)phenyl]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 142899776 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | ethane;N-(1-hydroxycyclopropyl)-1-[3-[4-(3-hydroxy-2-methylbut-3-enyl)phenyl]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | C=C(O)C(C)Cc1ccc(-c2cccc(-n3cc(C(=O)NC4(O)CC4)c(=O)c4cccnc43)c2)cc1.CC |
| InChI | InChI=1S/C29H27N3O4.C2H6/c1-18(19(2)33)15-20-8-10-21(11-9-20)22-5-3-6-23(16-22)32-17-25(28(35)31-29(36)12-13-29)26(34)24-7-4-14-30-27(24)32;1-2/h3-11,14,16-18,33,36H,2,12-13,15H2,1H3,(H,31,35);1-2H3 |
| InChIKey | DQRRQFVYXZHNHZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|