C16H15N3O2 — CID 14290449
3-(4,4-dimethyl-1,3-dioxido-5-phenylimidazole-1,3-diium-2-yl)pyridine (PubChem CID 14290449) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-(4,4-dimethyl-1,3-dioxido-5-phenylimidazole-1,3-diium-2-yl)pyridine.
| Compound Name | 3-(4,4-dimethyl-1,3-dioxido-5-phenylimidazole-1,3-diium-2-yl)pyridine |
|---|---|
| PubChem CID | 14290449 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(4,4-dimethyl-1,3-dioxido-5-phenylimidazole-1,3-diium-2-yl)pyridine |
| SMILES | CC1(C)C(c2ccccc2)=[N+]([O-])C(c2cccnc2)=[N+]1[O-] |
| InChI | InChI=1S/C16H15N3O2/c1-16(2)14(12-7-4-3-5-8-12)18(20)15(19(16)21)13-9-6-10-17-11-13/h3-11H,1-2H3 |
| InChIKey | CIBAMKREIAACLI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|