C12H17NO — CID 142904528
4-(7-methylcyclohepta-1,4,6-trien-1-yl)morpholine (PubChem CID 142904528) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(7-methylcyclohepta-1,4,6-trien-1-yl)morpholine.
| Compound Name | 4-(7-methylcyclohepta-1,4,6-trien-1-yl)morpholine |
|---|---|
| PubChem CID | 142904528 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(7-methylcyclohepta-1,4,6-trien-1-yl)morpholine |
| SMILES | CC1=CC=CCC=C1N1CCOCC1 |
| InChI | InChI=1S/C12H17NO/c1-11-5-3-2-4-6-12(11)13-7-9-14-10-8-13/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | SSWRLQDNMDAJQG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |