C15H23F2NO — CID 143325416
4-[(4Z)-4,5-difluoro-2,6-dimethylhepta-2,4,6-trien-3-yl]-2,6-dimethylmorpholine (PubChem CID 143325416) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-[(4Z)-4,5-difluoro-2,6-dimethylhepta-2,4,6-trien-3-yl]-2,6-dimethylmorpholine.
| Compound Name | 4-[(4Z)-4,5-difluoro-2,6-dimethylhepta-2,4,6-trien-3-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 143325416 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-[(4Z)-4,5-difluoro-2,6-dimethylhepta-2,4,6-trien-3-yl]-2,6-dimethylmorpholine |
| SMILES | C=C(C)/C(F)=C(\F)C(=C(C)C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C15H23F2NO/c1-9(2)13(16)14(17)15(10(3)4)18-7-11(5)19-12(6)8-18/h11-12H,1,7-8H2,2-6H3/b14-13- |
| InChIKey | MQTGDBRGLWCYKP-YPKPFQOOSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|