C21H22O — CID 142906660
(5Z)-5-[(2-methoxyphenyl)methylidene]-6,7-dimethyl-8,9-dihydrobenzo[7]annulene (PubChem CID 142906660) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is (5Z)-5-[(2-methoxyphenyl)methylidene]-6,7-dimethyl-8,9-dihydrobenzo[7]annulene.
| Compound Name | (5Z)-5-[(2-methoxyphenyl)methylidene]-6,7-dimethyl-8,9-dihydrobenzo[7]annulene |
|---|---|
| PubChem CID | 142906660 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (5Z)-5-[(2-methoxyphenyl)methylidene]-6,7-dimethyl-8,9-dihydrobenzo[7]annulene |
| SMILES | COc1ccccc1/C=C1/C(C)=C(C)CCc2ccccc21 |
| InChI | InChI=1S/C21H22O/c1-15-12-13-17-8-4-6-10-19(17)20(16(15)2)14-18-9-5-7-11-21(18)22-3/h4-11,14H,12-13H2,1-3H3/b20-14- |
| InChIKey | IOPLBONOXWXFDR-ZHZULCJRSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|