C10H17NO — CID 142908131
1-cyclohexa-1,5-dien-1-yloxy-N-methylpropan-2-amine (PubChem CID 142908131) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yloxy-N-methylpropan-2-amine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yloxy-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 142908131 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yloxy-N-methylpropan-2-amine |
| SMILES | CNC(C)COC1=CCCC=C1 |
| InChI | InChI=1S/C10H17NO/c1-9(11-2)8-12-10-6-4-3-5-7-10/h4,6-7,9,11H,3,5,8H2,1-2H3 |
| InChIKey | MPSIRORMQNKLDC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |