C19H18N4O — CID 142908651
6-(4-methoxyphenyl)-3-[(methylideneamino)methyl]-4-pyridin-3-ylpyridin-2-amine (PubChem CID 142908651) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3-[(methylideneamino)methyl]-4-pyridin-3-ylpyridin-2-amine.
| Compound Name | 6-(4-methoxyphenyl)-3-[(methylideneamino)methyl]-4-pyridin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 142908651 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 6-(4-methoxyphenyl)-3-[(methylideneamino)methyl]-4-pyridin-3-ylpyridin-2-amine |
| SMILES | C=NCc1c(-c2cccnc2)cc(-c2ccc(OC)cc2)nc1N |
| InChI | InChI=1S/C19H18N4O/c1-21-12-17-16(14-4-3-9-22-11-14)10-18(23-19(17)20)13-5-7-15(24-2)8-6-13/h3-11H,1,12H2,2H3,(H2,20,23) |
| InChIKey | SWKCMWBFNMLKKD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|