C22H25Cl2NO — CID 142910305
1-benzyl-4-[(E)-but-2-enoxy]-4-(3,4-dichlorophenyl)piperidine (PubChem CID 142910305) has the molecular formula C22H25Cl2NO and a molecular weight of 390.35 g/mol. Its IUPAC name is 1-benzyl-4-[(E)-but-2-enoxy]-4-(3,4-dichlorophenyl)piperidine.
| Compound Name | 1-benzyl-4-[(E)-but-2-enoxy]-4-(3,4-dichlorophenyl)piperidine |
|---|---|
| PubChem CID | 142910305 |
| Molecular Formula | C22H25Cl2NO |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-benzyl-4-[(E)-but-2-enoxy]-4-(3,4-dichlorophenyl)piperidine |
| SMILES | C/C=C/COC1(c2ccc(Cl)c(Cl)c2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25Cl2NO/c1-2-3-15-26-22(19-9-10-20(23)21(24)16-19)11-13-25(14-12-22)17-18-7-5-4-6-8-18/h2-10,16H,11-15,17H2,1H3/b3-2+ |
| InChIKey | WEJCBGFRHGDMID-NSCUHMNNSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|