About 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane
5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane (PubChem CID 142912129) has the molecular formula C8H13FN2O2
and a molecular weight of 188.20 g/mol. Its IUPAC name is 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane.
Molecular Properties
| Compound Name | 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane |
| PubChem CID | 142912129 |
| Molecular Formula | C8H13FN2O2 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane |
| SMILES | CCC1C(=O)C(C#N)CN1O.CF |
| InChI | InChI=1S/C7H10N2O2.CH3F/c1-2-6-7(10)5(3-8)4-9(6)11;1-2/h5-6,11H,2,4H2,1H3;1H3 |
| InChIKey | OXTBUYZUJKYEFA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane?
The IUPAC name of 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane (CID 142912129) is 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane.
What is the SMILES notation for 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane?
The canonical SMILES for 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane is CCC1C(=O)C(C#N)CN1O.CF.
What is the InChIKey of 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane?
The InChIKey is OXTBUYZUJKYEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2.CH3F/c1-2-6-7(10)5(3-8)4-9(6)11;1-2/h5-6,11H,2,4H2,1H3;1H3.
What are the key properties of 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane?
5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane has a molecular weight of 188.20 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-hydroxy-4-oxopyrrolidine-3-carbonitrile;fluoromethane is sourced from PubChem (CID 142912129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).