C18H24N4O — CID 142913175
(2R)-2-amino-3-(4-pyrimidin-2-ylphenyl)-1-pyrrolidin-1-ylpropan-1-one;methane (PubChem CID 142913175) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-pyrimidin-2-ylphenyl)-1-pyrrolidin-1-ylpropan-1-one;methane.
| Compound Name | (2R)-2-amino-3-(4-pyrimidin-2-ylphenyl)-1-pyrrolidin-1-ylpropan-1-one;methane |
|---|---|
| PubChem CID | 142913175 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2R)-2-amino-3-(4-pyrimidin-2-ylphenyl)-1-pyrrolidin-1-ylpropan-1-one;methane |
| SMILES | C.N[C@H](Cc1ccc(-c2ncccn2)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C17H20N4O.CH4/c18-15(17(22)21-10-1-2-11-21)12-13-4-6-14(7-5-13)16-19-8-3-9-20-16;/h3-9,15H,1-2,10-12,18H2;1H4/t15-;/m1./s1 |
| InChIKey | ARRZAMCMWCVOES-XFULWGLBSA-N |
| XLogP | 2.27 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |