C18H28 — CID 14291335
2,7-Dimethyl-4,5-bis(2-methylprop-1-enyl)octa-2,4,6-triene (PubChem CID 14291335) has the molecular formula C18H28 and a molecular weight of 244.40 g/mol. Its IUPAC name is 2,7-dimethyl-4,5-bis(2-methylprop-1-enyl)octa-2,4,6-triene.
| Compound Name | 2,7-Dimethyl-4,5-bis(2-methylprop-1-enyl)octa-2,4,6-triene |
|---|---|
| PubChem CID | 14291335 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2,7-dimethyl-4,5-bis(2-methylprop-1-enyl)octa-2,4,6-triene |
| SMILES | CC(=CC(=C(C=C(C)C)C=C(C)C)C=C(C)C)C |
| InChI | InChI=1S/C18H28/c1-13(2)9-17(10-14(3)4)18(11-15(5)6)12-16(7)8/h9-12H,1-8H3 |
| InChIKey | MQVAFBNKVGUTOK-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 337 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|