C20H26O5 — CID 142913667
(1S,2S)-1,8-dimethyl-6-propan-2-yl-3,9,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-ene-7,15-dione (PubChem CID 142913667) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1S,2S)-1,8-dimethyl-6-propan-2-yl-3,9,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-ene-7,15-dione.
| Compound Name | (1S,2S)-1,8-dimethyl-6-propan-2-yl-3,9,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-ene-7,15-dione |
|---|---|
| PubChem CID | 142913667 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,2S)-1,8-dimethyl-6-propan-2-yl-3,9,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-ene-7,15-dione |
| SMILES | CC(C)C1CC2O[C@]23C(C)(OCC2C4=C(CC[C@@]23C)C(=O)OC4)C1=O |
| InChI | InChI=1S/C20H26O5/c1-10(2)12-7-15-20(25-15)18(3)6-5-11-13(8-23-17(11)22)14(18)9-24-19(20,4)16(12)21/h10,12,14-15H,5-9H2,1-4H3/t12?,14?,15?,18-,19?,20+/m0/s1 |
| InChIKey | IEDSWAWWKJOYBE-PLUBKMBJSA-N |
| XLogP | 2.43 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|