C11H18O4 — CID 142913867
4,4-dimethoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-2-one (PubChem CID 142913867) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4,4-dimethoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-2-one.
| Compound Name | 4,4-dimethoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 142913867 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4,4-dimethoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-2-one |
| SMILES | COC1(OC)CC(=O)C2(C)CCC1(C)O2 |
| InChI | InChI=1S/C11H18O4/c1-9-5-6-10(2,15-9)11(13-3,14-4)7-8(9)12/h5-7H2,1-4H3 |
| InChIKey | ZDSKIGIBJXJVQS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|