C11H16O5 — CID 166444157
(3aS,7aS)-5-acetyl-3a,5,7a-trimethyl-6,7-dihydro-[1,3]dioxolo[4,5-b]pyran-2-one (PubChem CID 166444157) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3aS,7aS)-5-acetyl-3a,5,7a-trimethyl-6,7-dihydro-[1,3]dioxolo[4,5-b]pyran-2-one.
| Compound Name | (3aS,7aS)-5-acetyl-3a,5,7a-trimethyl-6,7-dihydro-[1,3]dioxolo[4,5-b]pyran-2-one |
|---|---|
| PubChem CID | 166444157 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3aS,7aS)-5-acetyl-3a,5,7a-trimethyl-6,7-dihydro-[1,3]dioxolo[4,5-b]pyran-2-one |
| SMILES | CC(=O)C1(C)CC[C@]2(C)OC(=O)O[C@]2(C)O1 |
| InChI | InChI=1S/C11H16O5/c1-7(12)9(2)5-6-10(3)11(4,16-9)15-8(13)14-10/h5-6H2,1-4H3/t9?,10-,11+/m0/s1 |
| InChIKey | KTOXYWTXAGMCLL-QXXIUIOUSA-N |
| XLogP | 1.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |