C26H38N2O4 — CID 142915173
N-ethyl-3,4-dimethoxy-N-[[2-methyl-4-[2-[methyl-[[(2R)-oxolan-2-yl]methyl]amino]ethoxy]phenyl]methyl]aniline (PubChem CID 142915173) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-ethyl-3,4-dimethoxy-N-[[2-methyl-4-[2-[methyl-[[(2R)-oxolan-2-yl]methyl]amino]ethoxy]phenyl]methyl]aniline.
| Compound Name | N-ethyl-3,4-dimethoxy-N-[[2-methyl-4-[2-[methyl-[[(2R)-oxolan-2-yl]methyl]amino]ethoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 142915173 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N-ethyl-3,4-dimethoxy-N-[[2-methyl-4-[2-[methyl-[[(2R)-oxolan-2-yl]methyl]amino]ethoxy]phenyl]methyl]aniline |
| SMILES | CCN(Cc1ccc(OCCN(C)C[C@H]2CCCO2)cc1C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H38N2O4/c1-6-28(22-10-12-25(29-4)26(17-22)30-5)18-21-9-11-23(16-20(21)2)32-15-13-27(3)19-24-8-7-14-31-24/h9-12,16-17,24H,6-8,13-15,18-19H2,1-5H3/t24-/m1/s1 |
| InChIKey | XHWFELMXPRFFOK-XMMPIXPASA-N |
| XLogP | 4.53 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|