C26H37FN2O4 — CID 142915178
N-ethyl-N-[[3-fluoro-4-[2-[methyl(oxan-4-ylmethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxyaniline (PubChem CID 142915178) has the molecular formula C26H37FN2O4 and a molecular weight of 460.59 g/mol. Its IUPAC name is N-ethyl-N-[[3-fluoro-4-[2-[methyl(oxan-4-ylmethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxyaniline.
| Compound Name | N-ethyl-N-[[3-fluoro-4-[2-[methyl(oxan-4-ylmethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 142915178 |
| Molecular Formula | C26H37FN2O4 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | N-ethyl-N-[[3-fluoro-4-[2-[methyl(oxan-4-ylmethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxyaniline |
| SMILES | CCN(Cc1ccc(OCCN(C)CC2CCOCC2)c(F)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H37FN2O4/c1-5-29(22-7-9-25(30-3)26(17-22)31-4)19-21-6-8-24(23(27)16-21)33-15-12-28(2)18-20-10-13-32-14-11-20/h6-9,16-17,20H,5,10-15,18-19H2,1-4H3 |
| InChIKey | OBGPUCNPVBACEJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|