About ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate
ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate (PubChem CID 142915931) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate.
Molecular Properties
| Compound Name | ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate |
| PubChem CID | 142915931 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate |
| SMILES | CC.CCCOC.COC(=O)C12CCC(C)(CC1)CC2 |
| InChI | InChI=1S/C11H18O2.C4H10O.C2H6/c1-10-3-6-11(7-4-10,8-5-10)9(12)13-2;1-3-4-5-2;1-2/h3-8H2,1-2H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | OCLHNBBKUPUXEG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate?
The IUPAC name of ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate (CID 142915931) is ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate.
What is the SMILES notation for ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate?
The canonical SMILES for ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate is CC.CCCOC.COC(=O)C12CCC(C)(CC1)CC2.
What is the InChIKey of ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate?
The InChIKey is OCLHNBBKUPUXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2.C4H10O.C2H6/c1-10-3-6-11(7-4-10,8-5-10)9(12)13-2;1-3-4-5-2;1-2/h3-8H2,1-2H3;3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate?
ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate has a molecular weight of 286.46 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxypropane;methyl 4-methylbicyclo[2.2.2]octane-1-carboxylate is sourced from PubChem (CID 142915931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).