C18H19ClN2O6 — CID 142916275
2-[3-chloro-5-(4-methyl-2-nitrophenoxy)phenyl]acetic acid;N-ethylformamide (PubChem CID 142916275) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is 2-[3-chloro-5-(4-methyl-2-nitrophenoxy)phenyl]acetic acid;N-ethylformamide.
| Compound Name | 2-[3-chloro-5-(4-methyl-2-nitrophenoxy)phenyl]acetic acid;N-ethylformamide |
|---|---|
| PubChem CID | 142916275 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[3-chloro-5-(4-methyl-2-nitrophenoxy)phenyl]acetic acid;N-ethylformamide |
| SMILES | CCNC=O.Cc1ccc(Oc2cc(Cl)cc(CC(=O)O)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12ClNO5.C3H7NO/c1-9-2-3-14(13(4-9)17(20)21)22-12-6-10(7-15(18)19)5-11(16)8-12;1-2-4-3-5/h2-6,8H,7H2,1H3,(H,18,19);3H,2H2,1H3,(H,4,5) |
| InChIKey | ANUPGRVFWJYKNE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|