C17H15ClN2O7 — CID 174498937
2-[3-chloro-5-[4-(ethylcarbamoyloxy)-2-nitrophenoxy]phenyl]acetic acid (PubChem CID 174498937) has the molecular formula C17H15ClN2O7 and a molecular weight of 394.77 g/mol. Its IUPAC name is 2-[3-chloro-5-[4-(ethylcarbamoyloxy)-2-nitrophenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-5-[4-(ethylcarbamoyloxy)-2-nitrophenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 174498937 |
| Molecular Formula | C17H15ClN2O7 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-[3-chloro-5-[4-(ethylcarbamoyloxy)-2-nitrophenoxy]phenyl]acetic acid |
| SMILES | CCNC(=O)Oc1ccc(Oc2cc(Cl)cc(CC(=O)O)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15ClN2O7/c1-2-19-17(23)27-12-3-4-15(14(9-12)20(24)25)26-13-6-10(7-16(21)22)5-11(18)8-13/h3-6,8-9H,2,7H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | WAUSYRRXVXUQSF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|