C18H18F3NO2S — CID 142916317
2-[4-[2-amino-4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid;prop-1-ene (PubChem CID 142916317) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[4-[2-amino-4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid;prop-1-ene.
| Compound Name | 2-[4-[2-amino-4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid;prop-1-ene |
|---|---|
| PubChem CID | 142916317 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[4-[2-amino-4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid;prop-1-ene |
| SMILES | C=CC.Nc1cc(C(F)(F)F)ccc1Sc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C15H12F3NO2S.C3H6/c16-15(17,18)10-3-6-13(12(19)8-10)22-11-4-1-9(2-5-11)7-14(20)21;1-3-2/h1-6,8H,7,19H2,(H,20,21);3H,1H2,2H3 |
| InChIKey | QMXGQXCRYUPRCP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|