C32H28F2N4O5 — CID 142917725
5,5-bis(4-fluorophenyl)-2-methyl-3-[[1-[(6-nitro-4-oxochromen-3-yl)methyl]piperidin-4-yl]methyl]imidazol-4-one (PubChem CID 142917725) has the molecular formula C32H28F2N4O5 and a molecular weight of 586.60 g/mol. Its IUPAC name is 5,5-bis(4-fluorophenyl)-2-methyl-3-[[1-[(6-nitro-4-oxochromen-3-yl)methyl]piperidin-4-yl]methyl]imidazol-4-one.
| Compound Name | 5,5-bis(4-fluorophenyl)-2-methyl-3-[[1-[(6-nitro-4-oxochromen-3-yl)methyl]piperidin-4-yl]methyl]imidazol-4-one |
|---|---|
| PubChem CID | 142917725 |
| Molecular Formula | C32H28F2N4O5 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 5,5-bis(4-fluorophenyl)-2-methyl-3-[[1-[(6-nitro-4-oxochromen-3-yl)methyl]piperidin-4-yl]methyl]imidazol-4-one |
| SMILES | CC1=NC(c2ccc(F)cc2)(c2ccc(F)cc2)C(=O)N1CC1CCN(Cc2coc3ccc([N+](=O)[O-])cc3c2=O)CC1 |
| InChI | InChI=1S/C32H28F2N4O5/c1-20-35-32(23-2-6-25(33)7-3-23,24-4-8-26(34)9-5-24)31(40)37(20)17-21-12-14-36(15-13-21)18-22-19-43-29-11-10-27(38(41)42)16-28(29)30(22)39/h2-11,16,19,21H,12-15,17-18H2,1H3 |
| InChIKey | TUJXOKNHTSGCRH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|