C29H26FN3O7 — CID 4181747
N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 4181747) has the molecular formula C29H26FN3O7 and a molecular weight of 547.54 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4181747 |
| Molecular Formula | C29H26FN3O7 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | COCCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H26FN3O7/c1-39-14-13-31(29(36)21-5-4-6-24(15-21)33(37)38)18-27(34)32(16-20-9-11-23(30)12-10-20)17-22-19-40-26-8-3-2-7-25(26)28(22)35/h2-12,15,19H,13-14,16-18H2,1H3 |
| InChIKey | BZHNYHFNKDDPAI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|