C17H25NO — CID 142918916
(E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide (PubChem CID 142918916) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide.
| Compound Name | (E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide |
|---|---|
| PubChem CID | 142918916 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide |
| SMILES | C=C/C=C(\C=C/C)/C=C(\C)CN(C)C(=O)/C(C)=C/C |
| InChI | InChI=1S/C17H25NO/c1-7-10-16(11-8-2)12-14(4)13-18(6)17(19)15(5)9-3/h7-12H,1,13H2,2-6H3/b11-8-,14-12+,15-9+,16-10+ |
| InChIKey | YMVKMJQQLXVOHB-NLAWJLBZSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|