C15H20N2OS — CID 142919535
N-[4-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylsulfanyl)phenyl]acetamide (PubChem CID 142919535) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N-[4-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylsulfanyl)phenyl]acetamide.
| Compound Name | N-[4-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 142919535 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-[4-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylsulfanyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SN2CCC3CCCC32)cc1 |
| InChI | InChI=1S/C15H20N2OS/c1-11(18)16-13-5-7-14(8-6-13)19-17-10-9-12-3-2-4-15(12)17/h5-8,12,15H,2-4,9-10H2,1H3,(H,16,18) |
| InChIKey | QGNPMJYWJAVNMY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|