C17H24N2OS — CID 143596211
acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine (PubChem CID 143596211) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine.
| Compound Name | acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine |
|---|---|
| PubChem CID | 143596211 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine |
| SMILES | C#C.C1CCNC1.CC(=O)Nc1ccc(SC2CC2)cc1 |
| InChI | InChI=1S/C11H13NOS.C4H9N.C2H2/c1-8(13)12-9-2-4-10(5-3-9)14-11-6-7-11;1-2-4-5-3-1;1-2/h2-5,11H,6-7H2,1H3,(H,12,13);5H,1-4H2;1-2H |
| InChIKey | HCMAQAAGDJLUHR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|