About acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine
acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine (PubChem CID 143596211) has the molecular formula C17H24N2OS
and a molecular weight of 304.46 g/mol. Its IUPAC name is acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine.
Molecular Properties
| Compound Name | acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine |
| PubChem CID | 143596211 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine |
| SMILES | C#C.C1CCNC1.CC(=O)Nc1ccc(SC2CC2)cc1 |
| InChI | InChI=1S/C11H13NOS.C4H9N.C2H2/c1-8(13)12-9-2-4-10(5-3-9)14-11-6-7-11;1-2-4-5-3-1;1-2/h2-5,11H,6-7H2,1H3,(H,12,13);5H,1-4H2;1-2H |
| InChIKey | HCMAQAAGDJLUHR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine?
The IUPAC name of acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine (CID 143596211) is acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine.
What is the SMILES notation for acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine?
The canonical SMILES for acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine is C#C.C1CCNC1.CC(=O)Nc1ccc(SC2CC2)cc1.
What is the InChIKey of acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine?
The InChIKey is HCMAQAAGDJLUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS.C4H9N.C2H2/c1-8(13)12-9-2-4-10(5-3-9)14-11-6-7-11;1-2-4-5-3-1;1-2/h2-5,11H,6-7H2,1H3,(H,12,13);5H,1-4H2;1-2H.
What are the key properties of acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine?
acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine has a molecular weight of 304.46 g/mol, XLogP of 3.52, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;N-(4-cyclopropylsulfanylphenyl)acetamide;pyrrolidine is sourced from PubChem (CID 143596211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).