C25H32ClF2N3O — CID 142919692
2-(5-chloro-2-methylphenyl)-1-(2-cyclohexylethyl)-N-(3,3-difluoropent-4-enyl)-5-methylimidazole-4-carboxamide (PubChem CID 142919692) has the molecular formula C25H32ClF2N3O and a molecular weight of 464.00 g/mol. Its IUPAC name is 2-(5-chloro-2-methylphenyl)-1-(2-cyclohexylethyl)-N-(3,3-difluoropent-4-enyl)-5-methylimidazole-4-carboxamide.
| Compound Name | 2-(5-chloro-2-methylphenyl)-1-(2-cyclohexylethyl)-N-(3,3-difluoropent-4-enyl)-5-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 142919692 |
| Molecular Formula | C25H32ClF2N3O |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-(5-chloro-2-methylphenyl)-1-(2-cyclohexylethyl)-N-(3,3-difluoropent-4-enyl)-5-methylimidazole-4-carboxamide |
| SMILES | C=CC(F)(F)CCNC(=O)c1nc(-c2cc(Cl)ccc2C)n(CCC2CCCCC2)c1C |
| InChI | InChI=1S/C25H32ClF2N3O/c1-4-25(27,28)13-14-29-24(32)22-18(3)31(15-12-19-8-6-5-7-9-19)23(30-22)21-16-20(26)11-10-17(21)2/h4,10-11,16,19H,1,5-9,12-15H2,2-3H3,(H,29,32) |
| InChIKey | PNFVMJUFWRPCJW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|