C19H22ClF2N5S — CID 142921501
[[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3,5-difluorophenyl]methylamino]thiourea (PubChem CID 142921501) has the molecular formula C19H22ClF2N5S and a molecular weight of 425.94 g/mol. Its IUPAC name is [[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3,5-difluorophenyl]methylamino]thiourea.
| Compound Name | [[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3,5-difluorophenyl]methylamino]thiourea |
|---|---|
| PubChem CID | 142921501 |
| Molecular Formula | C19H22ClF2N5S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3,5-difluorophenyl]methylamino]thiourea |
| SMILES | NC(=S)NNCc1cc(F)c(N2CCN(Cc3cccc(Cl)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H22ClF2N5S/c20-15-3-1-2-13(8-15)12-26-4-6-27(7-5-26)18-16(21)9-14(10-17(18)22)11-24-25-19(23)28/h1-3,8-10,24H,4-7,11-12H2,(H3,23,25,28) |
| InChIKey | XMACSHHXFMFZMA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|