C8H8N6O2S — CID 142921709
2-[(5-pyrimidin-4-yl-1H-1,2,4-triazol-3-yl)oxy]-N-sulfanylacetamide (PubChem CID 142921709) has the molecular formula C8H8N6O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-[(5-pyrimidin-4-yl-1H-1,2,4-triazol-3-yl)oxy]-N-sulfanylacetamide.
| Compound Name | 2-[(5-pyrimidin-4-yl-1H-1,2,4-triazol-3-yl)oxy]-N-sulfanylacetamide |
|---|---|
| PubChem CID | 142921709 |
| Molecular Formula | C8H8N6O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-[(5-pyrimidin-4-yl-1H-1,2,4-triazol-3-yl)oxy]-N-sulfanylacetamide |
| SMILES | O=C(COc1n[nH]c(-c2ccncn2)n1)NS |
| InChI | InChI=1S/C8H8N6O2S/c15-6(14-17)3-16-8-11-7(12-13-8)5-1-2-9-4-10-5/h1-2,4,17H,3H2,(H,14,15)(H,11,12,13) |
| InChIKey | TXVKJYKIOCVBDQ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|