C9H8N4OS3 — CID 142921691
2-[(5-pyrimidin-4-yl-1,3-thiazol-2-yl)sulfanyl]-N-sulfanylacetamide (PubChem CID 142921691) has the molecular formula C9H8N4OS3 and a molecular weight of 284.39 g/mol. Its IUPAC name is 2-[(5-pyrimidin-4-yl-1,3-thiazol-2-yl)sulfanyl]-N-sulfanylacetamide.
| Compound Name | 2-[(5-pyrimidin-4-yl-1,3-thiazol-2-yl)sulfanyl]-N-sulfanylacetamide |
|---|---|
| PubChem CID | 142921691 |
| Molecular Formula | C9H8N4OS3 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2-[(5-pyrimidin-4-yl-1,3-thiazol-2-yl)sulfanyl]-N-sulfanylacetamide |
| SMILES | O=C(CSc1ncc(-c2ccncn2)s1)NS |
| InChI | InChI=1S/C9H8N4OS3/c14-8(13-15)4-16-9-11-3-7(17-9)6-1-2-10-5-12-6/h1-3,5,15H,4H2,(H,13,14) |
| InChIKey | QLJNOPNLOQPLIW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|