C24H30ClN5O3 — CID 142922367
5-chloro-3-(methylamino)-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide;4-(dimethylamino)cyclohexane-1-carbaldehyde (PubChem CID 142922367) has the molecular formula C24H30ClN5O3 and a molecular weight of 471.99 g/mol. Its IUPAC name is 5-chloro-3-(methylamino)-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide;4-(dimethylamino)cyclohexane-1-carbaldehyde.
| Compound Name | 5-chloro-3-(methylamino)-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide;4-(dimethylamino)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 142922367 |
| Molecular Formula | C24H30ClN5O3 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 5-chloro-3-(methylamino)-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide;4-(dimethylamino)cyclohexane-1-carbaldehyde |
| SMILES | CN(C)C1CCC(C=O)CC1.CNc1c(C(=O)Nc2ccc(C)cn2)oc2ccc(Cl)nc12 |
| InChI | InChI=1S/C15H13ClN4O2.C9H17NO/c1-8-3-6-11(18-7-8)20-15(21)14-13(17-2)12-9(22-14)4-5-10(16)19-12;1-10(2)9-5-3-8(7-11)4-6-9/h3-7,17H,1-2H3,(H,18,20,21);7-9H,3-6H2,1-2H3 |
| InChIKey | QNZCWJJMFBSCCK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|