C19H33F3N2O — CID 142922997
(3E)-4,4-dimethyl-3-[methyl-[4-(trifluoromethyl)phenyl]hydrazinylidene]pentan-1-ol;ethane (PubChem CID 142922997) has the molecular formula C19H33F3N2O and a molecular weight of 362.48 g/mol. Its IUPAC name is (3E)-4,4-dimethyl-3-[methyl-[4-(trifluoromethyl)phenyl]hydrazinylidene]pentan-1-ol;ethane.
| Compound Name | (3E)-4,4-dimethyl-3-[methyl-[4-(trifluoromethyl)phenyl]hydrazinylidene]pentan-1-ol;ethane |
|---|---|
| PubChem CID | 142922997 |
| Molecular Formula | C19H33F3N2O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (3E)-4,4-dimethyl-3-[methyl-[4-(trifluoromethyl)phenyl]hydrazinylidene]pentan-1-ol;ethane |
| SMILES | CC.CC.CN(/N=C(\CCO)C(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N2O.2C2H6/c1-14(2,3)13(9-10-21)19-20(4)12-7-5-11(6-8-12)15(16,17)18;2*1-2/h5-8,21H,9-10H2,1-4H3;2*1-2H3/b19-13+;; |
| InChIKey | AOLNBENHIINJKR-BWSKXRJVSA-N |
| XLogP | 5.98 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|