C11H12ClF3N2O — CID 21398150
1-(chloromethyl)-3,3-dimethyl-1-[4-(trifluoromethyl)phenyl]urea (PubChem CID 21398150) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is 1-(chloromethyl)-3,3-dimethyl-1-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(chloromethyl)-3,3-dimethyl-1-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 21398150 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-(chloromethyl)-3,3-dimethyl-1-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C)C(=O)N(CCl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12ClF3N2O/c1-16(2)10(18)17(7-12)9-5-3-8(4-6-9)11(13,14)15/h3-6H,7H2,1-2H3 |
| InChIKey | BJHZWOVDXPXKLA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|