C14H16F6N2O2 — CID 11646151
1-ethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-dimethylurea (PubChem CID 11646151) has the molecular formula C14H16F6N2O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-ethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-dimethylurea.
| Compound Name | 1-ethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-dimethylurea |
|---|---|
| PubChem CID | 11646151 |
| Molecular Formula | C14H16F6N2O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-ethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-dimethylurea |
| SMILES | CCN(C(=O)N(C)C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F6N2O2/c1-4-22(11(23)21(2)3)10-7-5-9(6-8-10)12(24,13(15,16)17)14(18,19)20/h5-8,24H,4H2,1-3H3 |
| InChIKey | LHANPBUTLZHWKW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |