C19H24F6N2O5 — CID 87798925
3-[N-[ethyl(4-hydroxybutyl)carbamoyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanoic acid (PubChem CID 87798925) has the molecular formula C19H24F6N2O5 and a molecular weight of 474.40 g/mol. Its IUPAC name is 3-[N-[ethyl(4-hydroxybutyl)carbamoyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanoic acid.
| Compound Name | 3-[N-[ethyl(4-hydroxybutyl)carbamoyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanoic acid |
|---|---|
| PubChem CID | 87798925 |
| Molecular Formula | C19H24F6N2O5 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 3-[N-[ethyl(4-hydroxybutyl)carbamoyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanoic acid |
| SMILES | CCN(CCCCO)C(=O)N(CCC(=O)O)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H24F6N2O5/c1-2-26(10-3-4-12-28)16(31)27(11-9-15(29)30)14-7-5-13(6-8-14)17(32,18(20,21)22)19(23,24)25/h5-8,28,32H,2-4,9-12H2,1H3,(H,29,30) |
| InChIKey | ZPWBELIGJBGIAO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|