C14H22FN3O — CID 79154007
1-(3-aminopropyl)-3,3-diethyl-1-(4-fluorophenyl)urea (PubChem CID 79154007) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3,3-diethyl-1-(4-fluorophenyl)urea.
| Compound Name | 1-(3-aminopropyl)-3,3-diethyl-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 79154007 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(3-aminopropyl)-3,3-diethyl-1-(4-fluorophenyl)urea |
| SMILES | CCN(CC)C(=O)N(CCCN)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FN3O/c1-3-17(4-2)14(19)18(11-5-10-16)13-8-6-12(15)7-9-13/h6-9H,3-5,10-11,16H2,1-2H3 |
| InChIKey | POBHIAZJNUQCKG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |