C10H14FN3O — CID 43136215
1-(3-aminopropyl)-1-(4-fluorophenyl)urea (PubChem CID 43136215) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 1-(3-aminopropyl)-1-(4-fluorophenyl)urea.
| Compound Name | 1-(3-aminopropyl)-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 43136215 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(3-aminopropyl)-1-(4-fluorophenyl)urea |
| SMILES | NCCCN(C(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H14FN3O/c11-8-2-4-9(5-3-8)14(10(13)15)7-1-6-12/h2-5H,1,6-7,12H2,(H2,13,15) |
| InChIKey | KVPYWCZVCQDLEE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |