C15H25N3O — CID 79154788
1-[4-(aminomethyl)phenyl]-3,3-diethyl-1-propylurea (PubChem CID 79154788) has the molecular formula C15H25N3O and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-3,3-diethyl-1-propylurea.
| Compound Name | 1-[4-(aminomethyl)phenyl]-3,3-diethyl-1-propylurea |
|---|---|
| PubChem CID | 79154788 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-3,3-diethyl-1-propylurea |
| SMILES | CCCN(C(=O)N(CC)CC)c1ccc(CN)cc1 |
| InChI | InChI=1S/C15H25N3O/c1-4-11-18(15(19)17(5-2)6-3)14-9-7-13(12-16)8-10-14/h7-10H,4-6,11-12,16H2,1-3H3 |
| InChIKey | KKEFOYXFKQRMBQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |