C18H24F6N2OS — CID 10137545
1-butyl-3,3-diethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiourea (PubChem CID 10137545) has the molecular formula C18H24F6N2OS and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-butyl-3,3-diethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiourea.
| Compound Name | 1-butyl-3,3-diethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 10137545 |
| Molecular Formula | C18H24F6N2OS |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-butyl-3,3-diethyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiourea |
| SMILES | CCCCN(C(=S)N(CC)CC)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F6N2OS/c1-4-7-12-26(15(28)25(5-2)6-3)14-10-8-13(9-11-14)16(27,17(19,20)21)18(22,23)24/h8-11,27H,4-7,12H2,1-3H3 |
| InChIKey | XTLYBUORSQBFKU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|