C21H29NO4 — CID 142923300
ethane;methyl 2-oxo-2-[6-[(E)-pent-2-enoxy]-1H-indol-3-yl]acetate;prop-1-ene (PubChem CID 142923300) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethane;methyl 2-oxo-2-[6-[(E)-pent-2-enoxy]-1H-indol-3-yl]acetate;prop-1-ene.
| Compound Name | ethane;methyl 2-oxo-2-[6-[(E)-pent-2-enoxy]-1H-indol-3-yl]acetate;prop-1-ene |
|---|---|
| PubChem CID | 142923300 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethane;methyl 2-oxo-2-[6-[(E)-pent-2-enoxy]-1H-indol-3-yl]acetate;prop-1-ene |
| SMILES | C=CC.CC.CC/C=C/COc1ccc2c(C(=O)C(=O)OC)c[nH]c2c1 |
| InChI | InChI=1S/C16H17NO4.C3H6.C2H6/c1-3-4-5-8-21-11-6-7-12-13(10-17-14(12)9-11)15(18)16(19)20-2;1-3-2;1-2/h4-7,9-10,17H,3,8H2,1-2H3;3H,1H2,2H3;1-2H3/b5-4+;; |
| InChIKey | GYJSFNPSEIBDAQ-SFKRKKMESA-N |
| XLogP | 5.09 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|