C44H66Si6 — CID 14292410
trimethyl-[[[4-methyl-1,1-diphenyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl-diphenylsilyl]-trimethylsilylmethyl]silane (PubChem CID 14292410) has the molecular formula C44H66Si6 and a molecular weight of 763.53 g/mol. Its IUPAC name is trimethyl-[[[4-methyl-1,1-diphenyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl-diphenylsilyl]-trimethylsilylmethyl]silane.
| Compound Name | trimethyl-[[[4-methyl-1,1-diphenyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl-diphenylsilyl]-trimethylsilylmethyl]silane |
|---|---|
| PubChem CID | 14292410 |
| Molecular Formula | C44H66Si6 |
| Molecular Weight | 763.53 g/mol |
| Exact Mass | 762.38 |
| IUPAC Name | trimethyl-[[[4-methyl-1,1-diphenyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl-diphenylsilyl]-trimethylsilylmethyl]silane |
| SMILES | CC1=C(C[Si](c2ccccc2)(c2ccccc2)C([Si](C)(C)C)[Si](C)(C)C)C[Si](c2ccccc2)(c2ccccc2)C([Si](C)(C)C)([Si](C)(C)C)C1 |
| InChI | InChI=1S/C44H66Si6/c1-37-34-44(47(8,9)10,48(11,12)13)50(41-30-22-16-23-31-41,42-32-24-17-25-33-42)36-38(37)35-49(39-26-18-14-19-27-39,40-28-20-15-21-29-40)43(45(2,3)4)46(5,6)7/h14-33,43H,34-36H2,1-13H3 |
| InChIKey | XHCLVUNXOXLMDY-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.53 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|