About ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone
ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 142926583) has the molecular formula C14H34N2O
and a molecular weight of 246.44 g/mol. Its IUPAC name is ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone.
Molecular Properties
| Compound Name | ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone |
| PubChem CID | 142926583 |
| Molecular Formula | C14H34N2O |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.27 |
| IUPAC Name | ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | CC.CC.CC(=O)N1CCCC(C)C1.CNC |
| InChI | InChI=1S/C8H15NO.C2H7N.2C2H6/c1-7-4-3-5-9(6-7)8(2)10;1-3-2;2*1-2/h7H,3-6H2,1-2H3;3H,1-2H3;2*1-2H3 |
| InChIKey | ZDODRQHSCJNLLI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone?
The IUPAC name of ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone (CID 142926583) is ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone.
What is the SMILES notation for ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone?
The canonical SMILES for ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone is CC.CC.CC(=O)N1CCCC(C)C1.CNC.
What is the InChIKey of ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone?
The InChIKey is ZDODRQHSCJNLLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C2H7N.2C2H6/c1-7-4-3-5-9(6-7)8(2)10;1-3-2;2*1-2/h7H,3-6H2,1-2H3;3H,1-2H3;2*1-2H3.
What are the key properties of ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone?
ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone has a molecular weight of 246.44 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylmethanamine;1-(3-methylpiperidin-1-yl)ethanone is sourced from PubChem (CID 142926583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).