C9H17N3 — CID 142927527
(4E,5E)-4,5-di(ethylidene)-1H-imidazol-2-amine;ethane (PubChem CID 142927527) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1H-imidazol-2-amine;ethane.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1H-imidazol-2-amine;ethane |
|---|---|
| PubChem CID | 142927527 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1H-imidazol-2-amine;ethane |
| SMILES | C/C=c1/nc(N)[nH]/c1=C/C.CC |
| InChI | InChI=1S/C7H11N3.C2H6/c1-3-5-6(4-2)10-7(8)9-5;1-2/h3-4H,1-2H3,(H3,8,9,10);1-2H3/b5-3+,6-4+; |
| InChIKey | KMRIWMZUHSYEAK-WEUBHIEESA-N |
| XLogP | 0.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |