C31H28F2N4O4S — CID 142927568
1-[4-[3-[[(1E,5Z,7Z)-cycloocta-1,5,7-trien-1-yl]methyl]-1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea (PubChem CID 142927568) has the molecular formula C31H28F2N4O4S and a molecular weight of 590.65 g/mol. Its IUPAC name is 1-[4-[3-[[(1E,5Z,7Z)-cycloocta-1,5,7-trien-1-yl]methyl]-1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea.
| Compound Name | 1-[4-[3-[[(1E,5Z,7Z)-cycloocta-1,5,7-trien-1-yl]methyl]-1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea |
|---|---|
| PubChem CID | 142927568 |
| Molecular Formula | C31H28F2N4O4S |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 1-[4-[3-[[(1E,5Z,7Z)-cycloocta-1,5,7-trien-1-yl]methyl]-1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1ccc(-c2sc3c(c2C)c(=O)n(CC2=C/CC/C=C/C=C\2)c(=O)n3Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C31H28F2N4O4S/c1-19-26-28(38)36(17-20-9-6-4-3-5-7-10-20)31(40)37(18-23-24(32)11-8-12-25(23)33)29(26)42-27(19)21-13-15-22(16-14-21)34-30(39)35-41-2/h3-4,6,8-16H,5,7,17-18H2,1-2H3,(H2,34,35,39)/b4-3-,9-6-,20-10+ |
| InChIKey | HMYAEVJUJPHVBR-QDBNBMTDSA-N |
| XLogP | 6.04 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|